YIGSR-Lys (N3) [CAS 2415188-59-7]

YIGSR-Lys (N3) is a peptide that can inhibit the tumour growth and metastasis of leukaemic cells. YIGSR blocks the cellular binding to laminin I via a 67-kDa laminin-binding protein, and inhibits shear-induced increase in eNOS expression of laminin cells[1][2]. YIGSR-Lys (N3) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

[2415188-59-7]

C32H52N12O9

748.83

OC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](N)CC1=CC=C(O)C=C1)=O)[C@H](CC)C)=O)=O)CO)=O)CCCNC(N)=N)=O)CCCCN=[N+]=[N-])=O

NO Synthase

Room temperature