Z-D-Dbu (N3) -OH [CAS 1931958-82-5]

Z-D-Dbu (N3) -OH is a click chemistry reagent containing an azide group. Z-D-Dbu (N3) -OH can be used for the research of various biochemical[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups.

[1931958-82-5]

C12H14N4O4

278.26

[N-]=[N+]=NC[C@@H](CC(O)=O)NC(OCC1=CC=CC=C1)=O

ADC Linker

10 mM in DMSO

Room temperature