ZINC13000658 [CAS 1324070-76-9]

ZINC13000658 is a METTL inhibitor. ZINC13000658 exhibits significant anti proliferative activity in various cells and can induce G1 phase cell cycle arrest and apoptosis such as HepG2 (IC50 = 5.632 µM) and SNU-449 (IC50 = 6.184 µM) cells. ZINC13000658 may be related to the inhibition of the activity of multiple methyltransferases such as METTL1, 3, 6, 16, 18, etc. ZINC13000658 can be used for research on various types of cancer[1].

[1324070-76-9]

C21H19N3O3

361.39

COC1=CC=C2C(C=CN2CCNC(C3=CC(NC4=CC=CC=C43)=O)=O)=C1

Apoptosis; METTL3

Room temperature